C7H15NO4S — CID 155407178
N-hydroxy-2-methyl-2-methylsulfonylpentanamide (PubChem CID 155407178) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfonylpentanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfonylpentanamide |
|---|---|
| PubChem CID | 155407178 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfonylpentanamide |
| SMILES | CCCC(C)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C7H15NO4S/c1-4-5-7(2,6(9)8-10)13(3,11)12/h10H,4-5H2,1-3H3,(H,8,9) |
| InChIKey | ZGLRCXTZPMMRNQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|