C22H37N3O4S — CID 134394985
4-[butyl-[7-(dimethylamino)-2-ethenyl-2-methylhepta-3,5-diynyl]amino]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 134394985) has the molecular formula C22H37N3O4S and a molecular weight of 439.62 g/mol. Its IUPAC name is 4-[butyl-[7-(dimethylamino)-2-ethenyl-2-methylhepta-3,5-diynyl]amino]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | 4-[butyl-[7-(dimethylamino)-2-ethenyl-2-methylhepta-3,5-diynyl]amino]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 134394985 |
| Molecular Formula | C22H37N3O4S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 4-[butyl-[7-(dimethylamino)-2-ethenyl-2-methylhepta-3,5-diynyl]amino]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C=CC(C)(C#CC#CCN(C)C)CN(CCCC)CCC(C)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H37N3O4S/c1-8-10-17-25(18-15-22(4,20(26)23-27)30(7,28)29)19-21(3,9-2)14-12-11-13-16-24(5)6/h9,27H,2,8,10,15-19H2,1,3-7H3,(H,23,26) |
| InChIKey | BMUNCEZNBFORFI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|