C16H37N — CID 176957810
N-but-3-enyl-2,2-dimethyl-N-propylpropan-1-amine;ethane (PubChem CID 176957810) has the molecular formula C16H37N and a molecular weight of 243.48 g/mol. Its IUPAC name is N-but-3-enyl-2,2-dimethyl-N-propylpropan-1-amine;ethane.
| Compound Name | N-but-3-enyl-2,2-dimethyl-N-propylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 176957810 |
| Molecular Formula | C16H37N |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 243.29 |
| IUPAC Name | N-but-3-enyl-2,2-dimethyl-N-propylpropan-1-amine;ethane |
| SMILES | C=CCCN(CCC)CC(C)(C)C.CC.CC |
| InChI | InChI=1S/C12H25N.2C2H6/c1-6-8-10-13(9-7-2)11-12(3,4)5;2*1-2/h6H,1,7-11H2,2-5H3;2*1-2H3 |
| InChIKey | XZMDNMFNCNBEEE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|