C19H42N2 — CID 167212772
N'-(2,2-dimethylpropyl)-N-ethyl-N,2,2-trimethyl-N'-propylhexane-1,6-diamine (PubChem CID 167212772) has the molecular formula C19H42N2 and a molecular weight of 298.56 g/mol. Its IUPAC name is N'-(2,2-dimethylpropyl)-N-ethyl-N,2,2-trimethyl-N'-propylhexane-1,6-diamine.
| Compound Name | N'-(2,2-dimethylpropyl)-N-ethyl-N,2,2-trimethyl-N'-propylhexane-1,6-diamine |
|---|---|
| PubChem CID | 167212772 |
| Molecular Formula | C19H42N2 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 298.33 |
| IUPAC Name | N'-(2,2-dimethylpropyl)-N-ethyl-N,2,2-trimethyl-N'-propylhexane-1,6-diamine |
| SMILES | CCCN(CCCCC(C)(C)CN(C)CC)CC(C)(C)C |
| InChI | InChI=1S/C19H42N2/c1-9-14-21(16-18(3,4)5)15-12-11-13-19(6,7)17-20(8)10-2/h9-17H2,1-8H3 |
| InChIKey | RLJCLTHTYWHDHC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|