C26H21NO5S — CID 88996301
N-[(R)-1-benzofuran-2-yl-(2-ethynylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 88996301) has the molecular formula C26H21NO5S and a molecular weight of 459.52 g/mol. Its IUPAC name is N-[(R)-1-benzofuran-2-yl-(2-ethynylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-[(R)-1-benzofuran-2-yl-(2-ethynylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 88996301 |
| Molecular Formula | C26H21NO5S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | N-[(R)-1-benzofuran-2-yl-(2-ethynylphenyl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | C#Cc1ccccc1[C@@H](NS(=O)(=O)c1ccc2c(c1)OCCCO2)c1cc2ccccc2o1 |
| InChI | InChI=1S/C26H21NO5S/c1-2-18-8-3-5-10-21(18)26(25-16-19-9-4-6-11-22(19)32-25)27-33(28,29)20-12-13-23-24(17-20)31-15-7-14-30-23/h1,3-6,8-13,16-17,26-27H,7,14-15H2/t26-/m1/s1 |
| InChIKey | NFIJZHXUTBWBMN-AREMUKBSSA-N |
| XLogP | 4.64 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|