C24H21NO5S2 — CID 90188298
N-[(R)-1-benzofuran-2-yl-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide (PubChem CID 90188298) has the molecular formula C24H21NO5S2 and a molecular weight of 467.57 g/mol. Its IUPAC name is N-[(R)-1-benzofuran-2-yl-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide.
| Compound Name | N-[(R)-1-benzofuran-2-yl-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
|---|---|
| PubChem CID | 90188298 |
| Molecular Formula | C24H21NO5S2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | N-[(R)-1-benzofuran-2-yl-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)methyl]-3,4-dihydro-2H-1,5-benzodioxepine-7-sulfonamide |
| SMILES | O=S(=O)(N[C@H](C1=CC=CCC1=S)c1cc2ccccc2o1)c1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H21NO5S2/c26-32(27,17-10-11-20-21(15-17)29-13-5-12-28-20)25-24(18-7-2-4-9-23(18)31)22-14-16-6-1-3-8-19(16)30-22/h1-4,6-8,10-11,14-15,24-25H,5,9,12-13H2/t24-/m1/s1 |
| InChIKey | WRFFAJPWJJPAOQ-XMMPIXPASA-N |
| XLogP | 4.87 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|