C8H9N2O4- — CID 8899700
1-(2-methoxyethyl)-6-oxopyridazine-3-carboxylate (PubChem CID 8899700) has the molecular formula C8H9N2O4- and a molecular weight of 197.17 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-6-oxopyridazine-3-carboxylate.
| Compound Name | 1-(2-methoxyethyl)-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 8899700 |
| Molecular Formula | C8H9N2O4- |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 1-(2-methoxyethyl)-6-oxopyridazine-3-carboxylate |
| SMILES | COCCn1nc(C(=O)[O-])ccc1=O |
| InChI | InChI=1S/C8H10N2O4/c1-14-5-4-10-7(11)3-2-6(9-10)8(12)13/h2-3H,4-5H2,1H3,(H,12,13)/p-1 |
| InChIKey | RSOSHWXWMIHOSG-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 84.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |