C9H9F3N2O4 — CID 114696071
6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazine-3-carboxylic acid (PubChem CID 114696071) has the molecular formula C9H9F3N2O4 and a molecular weight of 266.17 g/mol. Its IUPAC name is 6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazine-3-carboxylic acid.
| Compound Name | 6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 114696071 |
| Molecular Formula | C9H9F3N2O4 |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 6-oxo-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(=O)n(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F3N2O4/c10-9(11,12)5-18-4-3-14-7(15)2-1-6(13-14)8(16)17/h1-2H,3-5H2,(H,16,17) |
| InChIKey | XAPSUTCPGQDGTQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|