C27H25ClFN5O3S — CID 89000536
(1S)-3-[2-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-fluoropyrimidin-4-yl]imino-1-prop-2-enylcyclohexan-1-ol (PubChem CID 89000536) has the molecular formula C27H25ClFN5O3S and a molecular weight of 554.05 g/mol. Its IUPAC name is (1S)-3-[2-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-fluoropyrimidin-4-yl]imino-1-prop-2-enylcyclohexan-1-ol.
| Compound Name | (1S)-3-[2-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-fluoropyrimidin-4-yl]imino-1-prop-2-enylcyclohexan-1-ol |
|---|---|
| PubChem CID | 89000536 |
| Molecular Formula | C27H25ClFN5O3S |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | (1S)-3-[2-[5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-3-yl]-5-fluoropyrimidin-4-yl]imino-1-prop-2-enylcyclohexan-1-ol |
| SMILES | C=CC[C@@]1(O)CCC/C(=N\c2nc(-c3cn(S(=O)(=O)c4ccc(C)cc4)c4ncc(Cl)cc34)ncc2F)C1 |
| InChI | InChI=1S/C27H25ClFN5O3S/c1-3-10-27(35)11-4-5-19(13-27)32-25-23(29)15-30-24(33-25)22-16-34(26-21(22)12-18(28)14-31-26)38(36,37)20-8-6-17(2)7-9-20/h3,6-9,12,14-16,35H,1,4-5,10-11,13H2,2H3/b32-19+/t27-/m1/s1 |
| InChIKey | YSYPXASTSXLVIM-BKZXGXTDSA-N |
| XLogP | 5.78 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|