C17H16FN3OS — CID 89003540
3-cyano-N-[(1R)-1-(4-fluorophenyl)ethyl]-5-[methyl(sulfanyl)amino]benzamide (PubChem CID 89003540) has the molecular formula C17H16FN3OS and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-cyano-N-[(1R)-1-(4-fluorophenyl)ethyl]-5-[methyl(sulfanyl)amino]benzamide.
| Compound Name | 3-cyano-N-[(1R)-1-(4-fluorophenyl)ethyl]-5-[methyl(sulfanyl)amino]benzamide |
|---|---|
| PubChem CID | 89003540 |
| Molecular Formula | C17H16FN3OS |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-cyano-N-[(1R)-1-(4-fluorophenyl)ethyl]-5-[methyl(sulfanyl)amino]benzamide |
| SMILES | C[C@@H](NC(=O)c1cc(C#N)cc(N(C)S)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FN3OS/c1-11(13-3-5-15(18)6-4-13)20-17(22)14-7-12(10-19)8-16(9-14)21(2)23/h3-9,11,23H,1-2H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | GZVWDDDKHPMYRB-LLVKDONJSA-N |
| XLogP | 3.47 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|