C17H18BrFN2O3S — CID 174505450
[3-bromo-5-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-N-methylanilino]methanesulfinic acid (PubChem CID 174505450) has the molecular formula C17H18BrFN2O3S and a molecular weight of 429.31 g/mol. Its IUPAC name is [3-bromo-5-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-N-methylanilino]methanesulfinic acid.
| Compound Name | [3-bromo-5-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-N-methylanilino]methanesulfinic acid |
|---|---|
| PubChem CID | 174505450 |
| Molecular Formula | C17H18BrFN2O3S |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | [3-bromo-5-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]-N-methylanilino]methanesulfinic acid |
| SMILES | C[C@@H](NC(=O)c1cc(Br)cc(N(C)CS(=O)O)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18BrFN2O3S/c1-11(12-3-5-15(19)6-4-12)20-17(22)13-7-14(18)9-16(8-13)21(2)10-25(23)24/h3-9,11H,10H2,1-2H3,(H,20,22)(H,23,24)/t11-/m1/s1 |
| InChIKey | ALKMGDAAERSCSV-LLVKDONJSA-N |
| XLogP | 3.69 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|