C23H19N5O — CID 8900417
4-[(Z)-[(Z)-(1-benzyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 8900417) has the molecular formula C23H19N5O and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[(Z)-[(Z)-(1-benzyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(Z)-[(Z)-(1-benzyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 8900417 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[(Z)-[(Z)-(1-benzyl-2-oxoindol-3-ylidene)hydrazinylidene]methyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=N\N=C2/C(=O)N(Cc3ccccc3)c3ccccc32)cc(C#N)n1C |
| InChI | InChI=1S/C23H19N5O/c1-16-18(12-19(13-24)27(16)2)14-25-26-22-20-10-6-7-11-21(20)28(23(22)29)15-17-8-4-3-5-9-17/h3-12,14H,15H2,1-2H3/b25-14-,26-22- |
| InChIKey | RTTTVZJQOWCCMV-UFIQNKAHSA-N |
| XLogP | 3.58 |
| TPSA | 73.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|