C22H18N4O — CID 9074428
1,5-dimethyl-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]pyrrole-2-carbonitrile (PubChem CID 9074428) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 9074428 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1,5-dimethyl-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=N\N=C(/C(=O)c2ccccc2)c2ccccc2)cc(C#N)n1C |
| InChI | InChI=1S/C22H18N4O/c1-16-19(13-20(14-23)26(16)2)15-24-25-21(17-9-5-3-6-10-17)22(27)18-11-7-4-8-12-18/h3-13,15H,1-2H3/b24-15-,25-21- |
| InChIKey | QPHLDWZTNQKTPQ-KBIDLLOISA-N |
| XLogP | 3.91 |
| TPSA | 70.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|