C23H19N5O2 — CID 9349588
4-[(Z)-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)iminomethyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 9349588) has the molecular formula C23H19N5O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 4-[(Z)-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)iminomethyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(Z)-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)iminomethyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 9349588 |
| Molecular Formula | C23H19N5O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[(Z)-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)iminomethyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=N\N2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc(C#N)n1C |
| InChI | InChI=1S/C23H19N5O2/c1-16-17(13-20(14-24)27(16)2)15-25-28-21(29)23(26-22(28)30,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-13,15H,1-2H3,(H,26,30)/b25-15- |
| InChIKey | QXCDDGQOAJAWLU-MYYYXRDXSA-N |
| XLogP | 3.03 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|