C21H18N6S — CID 9174410
1,5-dimethyl-4-[(Z)-[3-(naphthalen-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyrrole-2-carbonitrile (PubChem CID 9174410) has the molecular formula C21H18N6S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1,5-dimethyl-4-[(Z)-[3-(naphthalen-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyrrole-2-carbonitrile.
| Compound Name | 1,5-dimethyl-4-[(Z)-[3-(naphthalen-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 9174410 |
| Molecular Formula | C21H18N6S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 1,5-dimethyl-4-[(Z)-[3-(naphthalen-1-ylmethyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]iminomethyl]pyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=N\n2c(Cc3cccc4ccccc34)n[nH]c2=S)cc(C#N)n1C |
| InChI | InChI=1S/C21H18N6S/c1-14-17(10-18(12-22)26(14)2)13-23-27-20(24-25-21(27)28)11-16-8-5-7-15-6-3-4-9-19(15)16/h3-10,13H,11H2,1-2H3,(H,25,28)/b23-13- |
| InChIKey | HRGKLGPWULHNNS-QRVIBDJDSA-N |
| XLogP | 4.09 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|