C20H15N5O3S — CID 135775411
4-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(naphthalen-1-ylmethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 135775411) has the molecular formula C20H15N5O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is 4-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(naphthalen-1-ylmethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(naphthalen-1-ylmethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 135775411 |
| Molecular Formula | C20H15N5O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 4-[(E)-(2-hydroxy-5-nitrophenyl)methylideneamino]-3-(naphthalen-1-ylmethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1ccc(O)c(/C=N/n2c(Cc3cccc4ccccc34)n[nH]c2=S)c1 |
| InChI | InChI=1S/C20H15N5O3S/c26-18-9-8-16(25(27)28)10-15(18)12-21-24-19(22-23-20(24)29)11-14-6-3-5-13-4-1-2-7-17(13)14/h1-10,12,26H,11H2,(H,23,29)/b21-12+ |
| InChIKey | MGCLRIGEIFZLTH-CIAFOILYSA-N |
| XLogP | 4.18 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|