C24H21N3O4 — CID 9349596
3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 9349596) has the molecular formula C24H21N3O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9349596 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 3-[(Z)-(3,5-dimethoxyphenyl)methylideneamino]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | COc1cc(/C=N\N2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C24H21N3O4/c1-30-20-13-17(14-21(15-20)31-2)16-25-27-22(28)24(26-23(27)29,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,1-2H3,(H,26,29)/b25-16- |
| InChIKey | GUEDDCDYZSYQSC-XYGWBWBKSA-N |
| XLogP | 3.53 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|