C16H13BrN2O — CID 8832718
4-[(E)-3-(3-bromophenyl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile (PubChem CID 8832718) has the molecular formula C16H13BrN2O and a molecular weight of 329.20 g/mol. Its IUPAC name is 4-[(E)-3-(3-bromophenyl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile.
| Compound Name | 4-[(E)-3-(3-bromophenyl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 8832718 |
| Molecular Formula | C16H13BrN2O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 4-[(E)-3-(3-bromophenyl)-3-oxoprop-1-enyl]-1,5-dimethylpyrrole-2-carbonitrile |
| SMILES | Cc1c(/C=C/C(=O)c2cccc(Br)c2)cc(C#N)n1C |
| InChI | InChI=1S/C16H13BrN2O/c1-11-12(9-15(10-18)19(11)2)6-7-16(20)13-4-3-5-14(17)8-13/h3-9H,1-2H3/b7-6+ |
| InChIKey | FJPSXJZIYATIGM-VOTSOKGWSA-N |
| XLogP | 3.86 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|