C19H18N2O4 — CID 126826947
2-[5-[3-(5-cyano-1,2-dimethylpyrrol-3-yl)prop-2-enoyl]-2-methoxyphenyl]acetic acid (PubChem CID 126826947) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[5-[3-(5-cyano-1,2-dimethylpyrrol-3-yl)prop-2-enoyl]-2-methoxyphenyl]acetic acid.
| Compound Name | 2-[5-[3-(5-cyano-1,2-dimethylpyrrol-3-yl)prop-2-enoyl]-2-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 126826947 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-[5-[3-(5-cyano-1,2-dimethylpyrrol-3-yl)prop-2-enoyl]-2-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(C(=O)C=Cc2cc(C#N)n(C)c2C)cc1CC(=O)O |
| InChI | InChI=1S/C19H18N2O4/c1-12-13(9-16(11-20)21(12)2)4-6-17(22)14-5-7-18(25-3)15(8-14)10-19(23)24/h4-9H,10H2,1-3H3,(H,23,24) |
| InChIKey | QLCDBVZBVCARPE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|