C24H19N3O3 — CID 6909955
2-[2-methoxy-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]phenoxy]acetonitrile (PubChem CID 6909955) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-[2-methoxy-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 6909955 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[2-methoxy-4-[(Z)-[(Z)-(2-oxo-1,2-diphenylethylidene)hydrazinylidene]methyl]phenoxy]acetonitrile |
| SMILES | COc1cc(/C=N\N=C(/C(=O)c2ccccc2)c2ccccc2)ccc1OCC#N |
| InChI | InChI=1S/C24H19N3O3/c1-29-22-16-18(12-13-21(22)30-15-14-25)17-26-27-23(19-8-4-2-5-9-19)24(28)20-10-6-3-7-11-20/h2-13,16-17H,15H2,1H3/b26-17-,27-23- |
| InChIKey | JAIJJHQJWWBTLY-ARKBPZGMSA-N |
| XLogP | 4.30 |
| TPSA | 84.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|