C24H25N3O2 — CID 3249979
2-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,2-diphenylethanone (PubChem CID 3249979) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,2-diphenylethanone.
| Compound Name | 2-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 3249979 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylidenehydrazinylidene]-1,2-diphenylethanone |
| SMILES | COCCn1c(C)cc(C=NN=C(C(=O)c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C24H25N3O2/c1-18-16-22(19(2)27(18)14-15-29-3)17-25-26-23(20-10-6-4-7-11-20)24(28)21-12-8-5-9-13-21/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | KYKUNXXAOFXRQB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|