C19H23N3O4 — CID 3430156
N-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 3430156) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 3430156 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | COCCn1c(C)cc(C=NNC(=O)C2COc3ccccc3O2)c1C |
| InChI | InChI=1S/C19H23N3O4/c1-13-10-15(14(2)22(13)8-9-24-3)11-20-21-19(23)18-12-25-16-6-4-5-7-17(16)26-18/h4-7,10-11,18H,8-9,12H2,1-3H3,(H,21,23) |
| InChIKey | QSEWQVNWFBIIKM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|