C18H24N4O2 — CID 5021371
1-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea (PubChem CID 5021371) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea.
| Compound Name | 1-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 5021371 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-3-(2-methylphenyl)urea |
| SMILES | COCCn1c(C)cc(C=NNC(=O)Nc2ccccc2C)c1C |
| InChI | InChI=1S/C18H24N4O2/c1-13-7-5-6-8-17(13)20-18(23)21-19-12-16-11-14(2)22(15(16)3)9-10-24-4/h5-8,11-12H,9-10H2,1-4H3,(H2,20,21,23) |
| InChIKey | UHTBOOKQRUUUOV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 67.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|