C18H23N3O5 — CID 8900672
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-benzamidoacetate (PubChem CID 8900672) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-benzamidoacetate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-benzamidoacetate |
|---|---|
| PubChem CID | 8900672 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-benzamidoacetate |
| SMILES | O=C(COC(=O)CNC(=O)c1ccccc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H23N3O5/c22-15(21-18(25)20-14-9-5-2-6-10-14)12-26-16(23)11-19-17(24)13-7-3-1-4-8-13/h1,3-4,7-8,14H,2,5-6,9-12H2,(H,19,24)(H2,20,21,22,25) |
| InChIKey | ALXQHYGVZFJKCD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |