C38H34N4O5S3 — CID 89007367
1,3-bis[4-(6-methoxy-1,3-benzothiazol-2-yl)anilino]propan-2-yl 4-methylbenzenesulfonate (PubChem CID 89007367) has the molecular formula C38H34N4O5S3 and a molecular weight of 722.91 g/mol. Its IUPAC name is 1,3-bis[4-(6-methoxy-1,3-benzothiazol-2-yl)anilino]propan-2-yl 4-methylbenzenesulfonate.
| Compound Name | 1,3-bis[4-(6-methoxy-1,3-benzothiazol-2-yl)anilino]propan-2-yl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89007367 |
| Molecular Formula | C38H34N4O5S3 |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 722.17 |
| IUPAC Name | 1,3-bis[4-(6-methoxy-1,3-benzothiazol-2-yl)anilino]propan-2-yl 4-methylbenzenesulfonate |
| SMILES | COc1ccc2nc(-c3ccc(NCC(CNc4ccc(-c5nc6ccc(OC)cc6s5)cc4)OS(=O)(=O)c4ccc(C)cc4)cc3)sc2c1 |
| InChI | InChI=1S/C38H34N4O5S3/c1-24-4-16-32(17-5-24)50(43,44)47-31(22-39-27-10-6-25(7-11-27)37-41-33-18-14-29(45-2)20-35(33)48-37)23-40-28-12-8-26(9-13-28)38-42-34-19-15-30(46-3)21-36(34)49-38/h4-21,31,39-40H,22-23H2,1-3H3 |
| InChIKey | YQYFWMHZHJALIE-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|