C32H38F4N4O7S — CID 89008276
1-[(E)-2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-4-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]piperidine-4-carboxamide (PubChem CID 89008276) has the molecular formula C32H38F4N4O7S and a molecular weight of 698.74 g/mol. Its IUPAC name is 1-[(E)-2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-4-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-4-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 89008276 |
| Molecular Formula | C32H38F4N4O7S |
| Molecular Weight | 698.74 g/mol |
| Exact Mass | 698.24 |
| IUPAC Name | 1-[(E)-2-[4-(4-hydroxy-4-methylpiperidine-1-carbonyl)-2,6-dimethylphenyl]ethenyl]sulfonyl-4-[[3-(1,1,2,2-tetrafluoroethoxy)benzoyl]amino]piperidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCC(C)(O)CC2)cc(C)c1/C=C/S(=O)(=O)N1CCC(NC(=O)c2cccc(OC(F)(F)C(F)F)c2)(C(N)=O)CC1 |
| InChI | InChI=1S/C32H38F4N4O7S/c1-20-17-23(27(42)39-12-8-30(3,44)9-13-39)18-21(2)25(20)7-16-48(45,46)40-14-10-31(11-15-40,29(37)43)38-26(41)22-5-4-6-24(19-22)47-32(35,36)28(33)34/h4-7,16-19,28,44H,8-15H2,1-3H3,(H2,37,43)(H,38,41)/b16-7+ |
| InChIKey | YGPAYCQFZHWIJS-FRKPEAEDSA-N |
| XLogP | 3.58 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|