C27H36F4O2 — CID 89009010
2-[2-fluoro-4-[(E)-2-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]ethenyl]-3-(trifluoromethyl)phenyl]oxirane (PubChem CID 89009010) has the molecular formula C27H36F4O2 and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(E)-2-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]ethenyl]-3-(trifluoromethyl)phenyl]oxirane.
| Compound Name | 2-[2-fluoro-4-[(E)-2-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]ethenyl]-3-(trifluoromethyl)phenyl]oxirane |
|---|---|
| PubChem CID | 89009010 |
| Molecular Formula | C27H36F4O2 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 2-[2-fluoro-4-[(E)-2-[4-[(4-propylcyclohexyl)methoxy]cyclohexyl]ethenyl]-3-(trifluoromethyl)phenyl]oxirane |
| SMILES | CCCC1CCC(COC2CCC(/C=C/c3ccc(C4CO4)c(F)c3C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C27H36F4O2/c1-2-3-18-4-6-20(7-5-18)16-32-22-13-9-19(10-14-22)8-11-21-12-15-23(24-17-33-24)26(28)25(21)27(29,30)31/h8,11-12,15,18-20,22,24H,2-7,9-10,13-14,16-17H2,1H3/b11-8+ |
| InChIKey | WERNUOQZAXCIOO-DHZHZOJOSA-N |
| XLogP | 8.11 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|