C26H28F4O — CID 89009092
2-[3-(difluoromethyl)-2-fluoro-4-[3-fluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]phenyl]phenyl]oxirane (PubChem CID 89009092) has the molecular formula C26H28F4O and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-2-fluoro-4-[3-fluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]phenyl]phenyl]oxirane.
| Compound Name | 2-[3-(difluoromethyl)-2-fluoro-4-[3-fluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]phenyl]phenyl]oxirane |
|---|---|
| PubChem CID | 89009092 |
| Molecular Formula | C26H28F4O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-[3-(difluoromethyl)-2-fluoro-4-[3-fluoro-4-[(E)-2-(4-propylcyclohexyl)ethenyl]phenyl]phenyl]oxirane |
| SMILES | CCCC1CCC(/C=C/c2ccc(-c3ccc(C4CO4)c(F)c3C(F)F)cc2F)CC1 |
| InChI | InChI=1S/C26H28F4O/c1-2-3-16-4-6-17(7-5-16)8-9-18-10-11-19(14-22(18)27)20-12-13-21(23-15-31-23)25(28)24(20)26(29)30/h8-14,16-17,23,26H,2-7,15H2,1H3/b9-8+ |
| InChIKey | ADYVMKLYDTTWBL-CMDGGOBGSA-N |
| XLogP | 8.26 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|