C24H33F3O — CID 123640258
2-[4-[2-[2-(difluoromethyl)-3-fluoro-4-methylphenyl]ethenyl]cyclohexyl]-5-propyloxane (PubChem CID 123640258) has the molecular formula C24H33F3O and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-[2-[2-(difluoromethyl)-3-fluoro-4-methylphenyl]ethenyl]cyclohexyl]-5-propyloxane.
| Compound Name | 2-[4-[2-[2-(difluoromethyl)-3-fluoro-4-methylphenyl]ethenyl]cyclohexyl]-5-propyloxane |
|---|---|
| PubChem CID | 123640258 |
| Molecular Formula | C24H33F3O |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 2-[4-[2-[2-(difluoromethyl)-3-fluoro-4-methylphenyl]ethenyl]cyclohexyl]-5-propyloxane |
| SMILES | CCCC1CCC(C2CCC(C=Cc3ccc(C)c(F)c3C(F)F)CC2)OC1 |
| InChI | InChI=1S/C24H33F3O/c1-3-4-18-9-14-21(28-15-18)19-11-6-17(7-12-19)8-13-20-10-5-16(2)23(25)22(20)24(26)27/h5,8,10,13,17-19,21,24H,3-4,6-7,9,11-12,14-15H2,1-2H3 |
| InChIKey | WWZRAJCGEVWRHP-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |