C21H22IN3O — CID 89015533
(5S,6S)-2-amino-5-(4-cyclopropylphenyl)-6-(3-iodophenyl)-3,6-dimethyl-5H-pyrimidin-4-one (PubChem CID 89015533) has the molecular formula C21H22IN3O and a molecular weight of 459.33 g/mol. Its IUPAC name is (5S,6S)-2-amino-5-(4-cyclopropylphenyl)-6-(3-iodophenyl)-3,6-dimethyl-5H-pyrimidin-4-one.
| Compound Name | (5S,6S)-2-amino-5-(4-cyclopropylphenyl)-6-(3-iodophenyl)-3,6-dimethyl-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 89015533 |
| Molecular Formula | C21H22IN3O |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | (5S,6S)-2-amino-5-(4-cyclopropylphenyl)-6-(3-iodophenyl)-3,6-dimethyl-5H-pyrimidin-4-one |
| SMILES | CN1C(=O)[C@@H](c2ccc(C3CC3)cc2)[C@@](C)(c2cccc(I)c2)N=C1N |
| InChI | InChI=1S/C21H22IN3O/c1-21(16-4-3-5-17(22)12-16)18(19(26)25(2)20(23)24-21)15-10-8-14(9-11-15)13-6-7-13/h3-5,8-13,18H,6-7H2,1-2H3,(H2,23,24)/t18-,21-/m1/s1 |
| InChIKey | GDFBQEMPAVYZJP-WIYYLYMNSA-N |
| XLogP | 3.95 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|