C16H15N3O — CID 15054176
2-amino-3-methyl-5,5-diphenylimidazol-4-one (PubChem CID 15054176) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-amino-3-methyl-5,5-diphenylimidazol-4-one.
| Compound Name | 2-amino-3-methyl-5,5-diphenylimidazol-4-one |
|---|---|
| PubChem CID | 15054176 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-amino-3-methyl-5,5-diphenylimidazol-4-one |
| SMILES | CN1C(=O)C(c2ccccc2)(c2ccccc2)N=C1N |
| InChI | InChI=1S/C16H15N3O/c1-19-14(20)16(18-15(19)17,12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3,(H2,17,18) |
| InChIKey | RNWLAFWLSSMCLN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |