C27H28N2O2S — CID 89015629
2-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1H-indol-2-yl]-3-phenylpropanal (PubChem CID 89015629) has the molecular formula C27H28N2O2S and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1H-indol-2-yl]-3-phenylpropanal.
| Compound Name | 2-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1H-indol-2-yl]-3-phenylpropanal |
|---|---|
| PubChem CID | 89015629 |
| Molecular Formula | C27H28N2O2S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 2-[3-tert-butylsulfanyl-5-(pyridin-2-ylmethoxy)-1H-indol-2-yl]-3-phenylpropanal |
| SMILES | CC(C)(C)Sc1c(C(C=O)Cc2ccccc2)[nH]c2ccc(OCc3ccccn3)cc12 |
| InChI | InChI=1S/C27H28N2O2S/c1-27(2,3)32-26-23-16-22(31-18-21-11-7-8-14-28-21)12-13-24(23)29-25(26)20(17-30)15-19-9-5-4-6-10-19/h4-14,16-17,20,29H,15,18H2,1-3H3 |
| InChIKey | JIWJUSJBKOMTDP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|