C24H24FNO2 — CID 89016853
1-[(1S,2R)-2-(cyclopropylmethoxy)-2-(4-ethynylphenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one (PubChem CID 89016853) has the molecular formula C24H24FNO2 and a molecular weight of 377.46 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(cyclopropylmethoxy)-2-(4-ethynylphenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one.
| Compound Name | 1-[(1S,2R)-2-(cyclopropylmethoxy)-2-(4-ethynylphenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 89016853 |
| Molecular Formula | C24H24FNO2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[(1S,2R)-2-(cyclopropylmethoxy)-2-(4-ethynylphenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one |
| SMILES | C#Cc1ccc([C@@H](OCC2CC2)[C@H](c2ccc(F)cc2)N2CCCC2=O)cc1 |
| InChI | InChI=1S/C24H24FNO2/c1-2-17-7-9-20(10-8-17)24(28-16-18-5-6-18)23(26-15-3-4-22(26)27)19-11-13-21(25)14-12-19/h1,7-14,18,23-24H,3-6,15-16H2/t23-,24+/m0/s1 |
| InChIKey | PBKJTRFVSULSKW-BJKOFHAPSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|