C34H44O2S4 — CID 89017199
2,5-bis[(5-octylthiophen-2-yl)methyl]thieno[3,2-b]thiophene-3,6-dicarbaldehyde (PubChem CID 89017199) has the molecular formula C34H44O2S4 and a molecular weight of 612.99 g/mol. Its IUPAC name is 2,5-bis[(5-octylthiophen-2-yl)methyl]thieno[3,2-b]thiophene-3,6-dicarbaldehyde.
| Compound Name | 2,5-bis[(5-octylthiophen-2-yl)methyl]thieno[3,2-b]thiophene-3,6-dicarbaldehyde |
|---|---|
| PubChem CID | 89017199 |
| Molecular Formula | C34H44O2S4 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | 2,5-bis[(5-octylthiophen-2-yl)methyl]thieno[3,2-b]thiophene-3,6-dicarbaldehyde |
| SMILES | CCCCCCCCc1ccc(Cc2sc3c(C=O)c(Cc4ccc(CCCCCCCC)s4)sc3c2C=O)s1 |
| InChI | InChI=1S/C34H44O2S4/c1-3-5-7-9-11-13-15-25-17-19-27(37-25)21-31-29(23-35)33-34(39-31)30(24-36)32(40-33)22-28-20-18-26(38-28)16-14-12-10-8-6-4-2/h17-20,23-24H,3-16,21-22H2,1-2H3 |
| InChIKey | AANOYXZZHKWBKT-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|