C21H21N3O7 — CID 89021052
(1R,3S,13R,17S,18S)-17-(dimethylamino)-8,10,13,14-tetrahydroxy-12,16-dioxo-2-azapentacyclo[9.8.0.01,3.04,9.013,18]nonadeca-4(9),5,7,10,14-pentaene-15-carboxamide (PubChem CID 89021052) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is (1R,3S,13R,17S,18S)-17-(dimethylamino)-8,10,13,14-tetrahydroxy-12,16-dioxo-2-azapentacyclo[9.8.0.01,3.04,9.013,18]nonadeca-4(9),5,7,10,14-pentaene-15-carboxamide.
| Compound Name | (1R,3S,13R,17S,18S)-17-(dimethylamino)-8,10,13,14-tetrahydroxy-12,16-dioxo-2-azapentacyclo[9.8.0.01,3.04,9.013,18]nonadeca-4(9),5,7,10,14-pentaene-15-carboxamide |
|---|---|
| PubChem CID | 89021052 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (1R,3S,13R,17S,18S)-17-(dimethylamino)-8,10,13,14-tetrahydroxy-12,16-dioxo-2-azapentacyclo[9.8.0.01,3.04,9.013,18]nonadeca-4(9),5,7,10,14-pentaene-15-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cccc4[C@@H]4N[C@]34C[C@@H]12 |
| InChI | InChI=1S/C21H21N3O7/c1-24(2)13-8-6-20-12(14(26)10-7(16(20)23-20)4-3-5-9(10)25)18(29)21(8,31)17(28)11(15(13)27)19(22)30/h3-5,8,13,16,23,25-26,28,31H,6H2,1-2H3,(H2,22,30)/t8-,13-,16-,20+,21+/m0/s1 |
| InChIKey | RTDVKDKLPGPKBO-MXZFYDPXSA-N |
| XLogP | -0.81 |
| TPSA | 183.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|