C19H20BrN5 — CID 89023521
3-bromo-5-(2-methylidenecyclohexyl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 89023521) has the molecular formula C19H20BrN5 and a molecular weight of 398.31 g/mol. Its IUPAC name is 3-bromo-5-(2-methylidenecyclohexyl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-bromo-5-(2-methylidenecyclohexyl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 89023521 |
| Molecular Formula | C19H20BrN5 |
| Molecular Weight | 398.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-bromo-5-(2-methylidenecyclohexyl)-N-(pyridin-3-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=C1CCCCC1c1cc(NCc2cccnc2)n2ncc(Br)c2n1 |
| InChI | InChI=1S/C19H20BrN5/c1-13-5-2-3-7-15(13)17-9-18(22-11-14-6-4-8-21-10-14)25-19(24-17)16(20)12-23-25/h4,6,8-10,12,15,22H,1-3,5,7,11H2 |
| InChIKey | HBMIXFCXOLNAKI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|