C20H17N5O — CID 8902438
(E)-N-(3-ethylphenyl)-3-([1,2,4]triazolo[3,4-a]phthalazin-3-yl)prop-2-enamide (PubChem CID 8902438) has the molecular formula C20H17N5O and a molecular weight of 343.39 g/mol. Its IUPAC name is (E)-N-(3-ethylphenyl)-3-([1,2,4]triazolo[3,4-a]phthalazin-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-ethylphenyl)-3-([1,2,4]triazolo[3,4-a]phthalazin-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 8902438 |
| Molecular Formula | C20H17N5O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (E)-N-(3-ethylphenyl)-3-([1,2,4]triazolo[3,4-a]phthalazin-3-yl)prop-2-enamide |
| SMILES | CCc1cccc(NC(=O)/C=C/c2nnc3c4ccccc4cnn23)c1 |
| InChI | InChI=1S/C20H17N5O/c1-2-14-6-5-8-16(12-14)22-19(26)11-10-18-23-24-20-17-9-4-3-7-15(17)13-21-25(18)20/h3-13H,2H2,1H3,(H,22,26)/b11-10+ |
| InChIKey | AVVJPLHDOOWZOF-ZHACJKMWSA-N |
| XLogP | 3.49 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|