C26H22N5O2PS — CID 142871405
(E)-N-[3-[[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 142871405) has the molecular formula C26H22N5O2PS and a molecular weight of 499.54 g/mol. Its IUPAC name is (E)-N-[3-[[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[3-[[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 142871405 |
| Molecular Formula | C26H22N5O2PS |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | (E)-N-[3-[[[5-(2-hydroxyphenyl)-3-phosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1cccc(CNc2cc(-c3ccccc3O)nc3c(P)cnn23)c1 |
| InChI | InChI=1S/C26H22N5O2PS/c32-22-9-2-1-8-20(22)21-14-24(31-26(30-21)23(34)16-28-31)27-15-17-5-3-6-18(13-17)29-25(33)11-10-19-7-4-12-35-19/h1-14,16,27,32H,15,34H2,(H,29,33)/b11-10+ |
| InChIKey | OYWVROSHAKXIBR-ZHACJKMWSA-N |
| XLogP | 4.93 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|