C28H29N6O4P — CID 142871021
formamide;4-[[3-[[[5-(2-hydroxyphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]anilino]methyl]benzene-1,3-diol (PubChem CID 142871021) has the molecular formula C28H29N6O4P and a molecular weight of 544.55 g/mol. Its IUPAC name is formamide;4-[[3-[[[5-(2-hydroxyphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]anilino]methyl]benzene-1,3-diol.
| Compound Name | formamide;4-[[3-[[[5-(2-hydroxyphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]anilino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 142871021 |
| Molecular Formula | C28H29N6O4P |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | formamide;4-[[3-[[[5-(2-hydroxyphenyl)-3-methylphosphanylpyrazolo[1,5-a]pyrimidin-7-yl]amino]methyl]anilino]methyl]benzene-1,3-diol |
| SMILES | CPc1cnn2c(NCc3cccc(NCc4ccc(O)cc4O)c3)cc(-c3ccccc3O)nc12.NC=O |
| InChI | InChI=1S/C27H26N5O3P.CH3NO/c1-36-25-16-30-32-26(13-22(31-27(25)32)21-7-2-3-8-23(21)34)29-14-17-5-4-6-19(11-17)28-15-18-9-10-20(33)12-24(18)35;2-1-3/h2-13,16,28-29,33-36H,14-15H2,1H3;1H,(H2,2,3) |
| InChIKey | KDFLAFYSSXBGCR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 158.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|