C17H24O — CID 89026361
1-(3-methylbuta-1,3-dien-2-yl)-4-(2-methylbutan-2-yloxymethyl)benzene (PubChem CID 89026361) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(3-methylbuta-1,3-dien-2-yl)-4-(2-methylbutan-2-yloxymethyl)benzene.
| Compound Name | 1-(3-methylbuta-1,3-dien-2-yl)-4-(2-methylbutan-2-yloxymethyl)benzene |
|---|---|
| PubChem CID | 89026361 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(3-methylbuta-1,3-dien-2-yl)-4-(2-methylbutan-2-yloxymethyl)benzene |
| SMILES | C=C(C)C(=C)c1ccc(COC(C)(C)CC)cc1 |
| InChI | InChI=1S/C17H24O/c1-7-17(5,6)18-12-15-8-10-16(11-9-15)14(4)13(2)3/h8-11H,2,4,7,12H2,1,3,5-6H3 |
| InChIKey | SSICFXFRJXEOKQ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|