C18H19ClN2O3 — CID 89027816
(5-chloro-1H-indol-2-yl)-[(3S)-3-(2-hydroxy-2-methylbut-3-ynoxy)pyrrolidin-1-yl]methanone (PubChem CID 89027816) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is (5-chloro-1H-indol-2-yl)-[(3S)-3-(2-hydroxy-2-methylbut-3-ynoxy)pyrrolidin-1-yl]methanone.
| Compound Name | (5-chloro-1H-indol-2-yl)-[(3S)-3-(2-hydroxy-2-methylbut-3-ynoxy)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 89027816 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | (5-chloro-1H-indol-2-yl)-[(3S)-3-(2-hydroxy-2-methylbut-3-ynoxy)pyrrolidin-1-yl]methanone |
| SMILES | C#CC(C)(O)CO[C@H]1CCN(C(=O)c2cc3cc(Cl)ccc3[nH]2)C1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-3-18(2,23)11-24-14-6-7-21(10-14)17(22)16-9-12-8-13(19)4-5-15(12)20-16/h1,4-5,8-9,14,20,23H,6-7,10-11H2,2H3/t14-,18?/m0/s1 |
| InChIKey | ZHMAYJGCOOWWAJ-PIVQAISJSA-N |
| XLogP | 2.44 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|