C19H17ClFN3O3 — CID 8902799
N'-[(Z)-[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide (PubChem CID 8902799) has the molecular formula C19H17ClFN3O3 and a molecular weight of 389.81 g/mol. Its IUPAC name is N'-[(Z)-[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide.
| Compound Name | N'-[(Z)-[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide |
|---|---|
| PubChem CID | 8902799 |
| Molecular Formula | C19H17ClFN3O3 |
| Molecular Weight | 389.81 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N'-[(Z)-[3-chloro-4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-N-cyclopropyloxamide |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(F)cc2)c(Cl)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C19H17ClFN3O3/c20-16-9-13(10-22-24-19(26)18(25)23-15-6-7-15)3-8-17(16)27-11-12-1-4-14(21)5-2-12/h1-5,8-10,15H,6-7,11H2,(H,23,25)(H,24,26)/b22-10- |
| InChIKey | IQEWYGISLGUGHG-YVNNLAQVSA-N |
| XLogP | 2.79 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.81 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|