C20H18ClN3O5 — CID 8989479
4-[[2-chloro-4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 8989479) has the molecular formula C20H18ClN3O5 and a molecular weight of 415.83 g/mol. Its IUPAC name is 4-[[2-chloro-4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-chloro-4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 8989479 |
| Molecular Formula | C20H18ClN3O5 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 4-[[2-chloro-4-[(Z)-[[2-(cyclopropylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(N/N=C\c1ccc(OCc2ccc(C(=O)O)cc2)c(Cl)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C20H18ClN3O5/c21-16-9-13(10-22-24-19(26)18(25)23-15-6-7-15)3-8-17(16)29-11-12-1-4-14(5-2-12)20(27)28/h1-5,8-10,15H,6-7,11H2,(H,23,25)(H,24,26)(H,27,28)/b22-10- |
| InChIKey | MTYAXLRLOUCVSN-YVNNLAQVSA-N |
| XLogP | 2.35 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|