C18H18F2N4O2 — CID 89028781
2-amino-5-[3-(3-aminophenyl)phenyl]-3-(2,2-difluoro-2-hydroxyethyl)-5-methylimidazol-4-one (PubChem CID 89028781) has the molecular formula C18H18F2N4O2 and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-amino-5-[3-(3-aminophenyl)phenyl]-3-(2,2-difluoro-2-hydroxyethyl)-5-methylimidazol-4-one.
| Compound Name | 2-amino-5-[3-(3-aminophenyl)phenyl]-3-(2,2-difluoro-2-hydroxyethyl)-5-methylimidazol-4-one |
|---|---|
| PubChem CID | 89028781 |
| Molecular Formula | C18H18F2N4O2 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-amino-5-[3-(3-aminophenyl)phenyl]-3-(2,2-difluoro-2-hydroxyethyl)-5-methylimidazol-4-one |
| SMILES | CC1(c2cccc(-c3cccc(N)c3)c2)N=C(N)N(CC(O)(F)F)C1=O |
| InChI | InChI=1S/C18H18F2N4O2/c1-17(15(25)24(16(22)23-17)10-18(19,20)26)13-6-2-4-11(8-13)12-5-3-7-14(21)9-12/h2-9,26H,10,21H2,1H3,(H2,22,23) |
| InChIKey | DIAGRKIKLZAARZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|