C17H19N5O — CID 70316871
4-amino-6-[3-(3-aminophenyl)phenyl]-3,6-dimethyl-1H-1,3,5-triazin-2-one (PubChem CID 70316871) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is 4-amino-6-[3-(3-aminophenyl)phenyl]-3,6-dimethyl-1H-1,3,5-triazin-2-one.
| Compound Name | 4-amino-6-[3-(3-aminophenyl)phenyl]-3,6-dimethyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 70316871 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-amino-6-[3-(3-aminophenyl)phenyl]-3,6-dimethyl-1H-1,3,5-triazin-2-one |
| SMILES | CN1C(=O)NC(C)(c2cccc(-c3cccc(N)c3)c2)N=C1N |
| InChI | InChI=1S/C17H19N5O/c1-17(20-15(19)22(2)16(23)21-17)13-7-3-5-11(9-13)12-6-4-8-14(18)10-12/h3-10H,18H2,1-2H3,(H2,19,20)(H,21,23) |
| InChIKey | DDYQSPNRQVWDDM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|