C22H20N6O — CID 59386612
6-amino-8-[3-(3-isocyanophenyl)phenyl]-2,5,8-trimethylpyrazolo[3,4-e][1,3]diazepin-4-one (PubChem CID 59386612) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is 6-amino-8-[3-(3-isocyanophenyl)phenyl]-2,5,8-trimethylpyrazolo[3,4-e][1,3]diazepin-4-one.
| Compound Name | 6-amino-8-[3-(3-isocyanophenyl)phenyl]-2,5,8-trimethylpyrazolo[3,4-e][1,3]diazepin-4-one |
|---|---|
| PubChem CID | 59386612 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 6-amino-8-[3-(3-isocyanophenyl)phenyl]-2,5,8-trimethylpyrazolo[3,4-e][1,3]diazepin-4-one |
| SMILES | [C-]#[N+]c1cccc(-c2cccc(C3(C)N=C(N)N(C)C(=O)c4cn(C)nc43)c2)c1 |
| InChI | InChI=1S/C22H20N6O/c1-22(19-18(13-27(3)26-19)20(29)28(4)21(23)25-22)16-9-5-7-14(11-16)15-8-6-10-17(12-15)24-2/h5-13H,1,3-4H3,(H2,23,25) |
| InChIKey | ZJLOWQHLGZVISH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|