C86H164N2O8 — CID 89031725
1-ethenoxybutyl 20-[1-[[20-(1-ethenoxybutoxy)-10,11-dioctyl-20-oxoicosanoyl]amino]ethylamino]-10,11-dioctyl-20-oxoicosanoate (PubChem CID 89031725) has the molecular formula C86H164N2O8 and a molecular weight of 1354.26 g/mol. Its IUPAC name is 1-ethenoxybutyl 20-[1-[[20-(1-ethenoxybutoxy)-10,11-dioctyl-20-oxoicosanoyl]amino]ethylamino]-10,11-dioctyl-20-oxoicosanoate.
| Compound Name | 1-ethenoxybutyl 20-[1-[[20-(1-ethenoxybutoxy)-10,11-dioctyl-20-oxoicosanoyl]amino]ethylamino]-10,11-dioctyl-20-oxoicosanoate |
|---|---|
| PubChem CID | 89031725 |
| Molecular Formula | C86H164N2O8 |
| Molecular Weight | 1354.26 g/mol |
| Exact Mass | 1353.25 |
| IUPAC Name | 1-ethenoxybutyl 20-[1-[[20-(1-ethenoxybutoxy)-10,11-dioctyl-20-oxoicosanoyl]amino]ethylamino]-10,11-dioctyl-20-oxoicosanoate |
| SMILES | C=COC(CCC)OC(=O)CCCCCCCCC(CCCCCCCC)C(CCCCCCCC)CCCCCCCCC(=O)NC(C)NC(=O)CCCCCCCCC(CCCCCCCC)C(CCCCCCCC)CCCCCCCCC(=O)OC(CCC)OC=C |
| InChI | InChI=1S/C86H164N2O8/c1-10-18-22-26-38-50-64-77(79(66-52-40-28-24-20-12-3)70-56-44-32-36-48-60-74-83(91)95-85(62-14-5)93-16-7)68-54-42-30-34-46-58-72-81(89)87-76(9)88-82(90)73-59-47-35-31-43-55-69-78(65-51-39-27-23-19-11-2)80(67-53-41-29-25-21-13-4)71-57-45-33-37-49-61-75-84(92)96-86(63-15-6)94-17-8/h16-17,76-80,85-86H,7-8,10-15,18-75H2,1-6,9H3,(H,87,89)(H,88,90) |
| InChIKey | JAHFXJXGKAGWAS-UHFFFAOYSA-N |
| XLogP | 27.17 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 78 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1354.26 |
| LogP ≤ 5 | 27.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|