C19H25N — CID 89037730
(3R)-1-benzyl-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrrolidine (PubChem CID 89037730) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is (3R)-1-benzyl-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrrolidine.
| Compound Name | (3R)-1-benzyl-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrrolidine |
|---|---|
| PubChem CID | 89037730 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (3R)-1-benzyl-3-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]pyrrolidine |
| SMILES | C/C=C\C=C(/C=C\C)[C@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H25N/c1-3-5-12-18(9-4-2)19-13-14-20(16-19)15-17-10-7-6-8-11-17/h3-12,19H,13-16H2,1-2H3/b5-3-,9-4-,18-12+/t19-/m0/s1 |
| InChIKey | HWSYSNWECKQNMI-ZCIJYHGWSA-N |
| XLogP | 4.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|