C23H25N3O5S — CID 89040630
(2S)-1-(3-hydroxyphenyl)sulfonyl-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]piperidine-2-carboxamide (PubChem CID 89040630) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is (2S)-1-(3-hydroxyphenyl)sulfonyl-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-(3-hydroxyphenyl)sulfonyl-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 89040630 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (2S)-1-(3-hydroxyphenyl)sulfonyl-N-[(2S)-1-(1H-indol-3-yl)-3-oxopropan-2-yl]piperidine-2-carboxamide |
| SMILES | O=C[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H]1CCCCN1S(=O)(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C23H25N3O5S/c27-15-17(12-16-14-24-21-9-2-1-8-20(16)21)25-23(29)22-10-3-4-11-26(22)32(30,31)19-7-5-6-18(28)13-19/h1-2,5-9,13-15,17,22,24,28H,3-4,10-12H2,(H,25,29)/t17-,22-/m0/s1 |
| InChIKey | NXYOISDFHDUQBS-JTSKRJEESA-N |
| XLogP | 2.34 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|