C26H19F2N3O2S — CID 89041218
3-[(2,4-difluorophenyl)methyl]-1-(2-methoxy-3-pyridinyl)-N-sulfanylbenzo[e]indole-2-carboxamide (PubChem CID 89041218) has the molecular formula C26H19F2N3O2S and a molecular weight of 475.52 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-1-(2-methoxy-3-pyridinyl)-N-sulfanylbenzo[e]indole-2-carboxamide.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-1-(2-methoxy-3-pyridinyl)-N-sulfanylbenzo[e]indole-2-carboxamide |
|---|---|
| PubChem CID | 89041218 |
| Molecular Formula | C26H19F2N3O2S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-1-(2-methoxy-3-pyridinyl)-N-sulfanylbenzo[e]indole-2-carboxamide |
| SMILES | COc1ncccc1-c1c(C(=O)NS)n(Cc2ccc(F)cc2F)c2ccc3ccccc3c12 |
| InChI | InChI=1S/C26H19F2N3O2S/c1-33-26-19(7-4-12-29-26)23-22-18-6-3-2-5-15(18)9-11-21(22)31(24(23)25(32)30-34)14-16-8-10-17(27)13-20(16)28/h2-13,34H,14H2,1H3,(H,30,32) |
| InChIKey | QTJCHFKTBHITGQ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|